4-Chloro-6-methylquinoline
Catalog No: FT-0618138
CAS No: 18436-71-0
- Molecular Formula: 177.63
- Formula Weight: C10H8ClN
- Inchl Key: HZWWPOQFLMUYOX-UHFFFAOYSA-N
- Inchl: InChI=1S/C10H8ClN/c1-7-2-3-10-8(6-7)9(11)4-5-12-10/h2-6H,1H3
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 177.630 |
| Density: | 1.2±0.1 g/cm3 |
| CAS: | 18436-71-0 |
| Bolling_Point: | 275.6±20.0 °C at 760 mmHg |
| Product_Name: | 4-Chloro-6-methylquinoline |
| Melting_Point: | N/A |
| Flash_Point: | 147.0±7.4 °C |
| MF: | C10H8ClN |
| Density: | 1.2±0.1 g/cm3 |
|---|---|
| LogP: | 3.24 |
| Flash_Point: | 147.0±7.4 °C |
| Refractive_Index: | 1.635 |
| FW: | 177.630 |
| PSA: | 12.89000 |
| MF: | C10H8ClN |
| Bolling_Point: | 275.6±20.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.5 mmHg at 25°C |
| Exact_Mass: | 177.034531 |
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H302-H315-H318-H335 |
| Symbol: | Danger |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933499090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)