2',4',5'-TRIMETHOXYACETOPHENONE
Catalog No: FT-0609817
CAS No: 1818-28-6
- Chemical Name: 2',4',5'-TRIMETHOXYACETOPHENONE
- Molecular Formula: C11H14O4
- Molecular Weight: 210.23
- InChI Key: GUTMBHHLVSFJIP-UHFFFAOYSA-N
- InChI: InChI=1S/C11H14O4/c1-7(12)8-5-10(14-3)11(15-4)6-9(8)13-2/h5-6H,1-4H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 1818-28-6 |
| Flash_Point: | 144.4ºC |
| Product_Name: | 1-(2,4,5-trimethoxyphenyl)ethanone |
| Bolling_Point: | 328.3ºC at 760 mmHg |
| FW: | 210.22600 |
| Melting_Point: | N/A |
| MF: | C11H14O4 |
| Density: | 1.089 g/cm3 |
| Refractive_Index: | 1.495 |
|---|---|
| Vapor_Pressure: | 0.000191mmHg at 25°C |
| MF: | C11H14O4 |
| Flash_Point: | 144.4ºC |
| LogP: | 1.91500 |
| FW: | 210.22600 |
| Density: | 1.089 g/cm3 |
| PSA: | 44.76000 |
| Bolling_Point: | 328.3ºC at 760 mmHg |
| Exact_Mass: | 210.08900 |
| Symbol: | GHS07 |
|---|---|
| HS_Code: | 2914509090 |
| RIDADR: | NONH for all modes of transport |
| Warning_Statement: | P305 + P351 + P338 |
| Safety_Statements: | H319 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)