![2-[[(2R)-oxiran-2-yl]methyl]isoindole-1,3-dione (CAS: 181140-34-1) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0771783.png "2-[[(2R)-oxiran-2-yl]methyl]isoindole-1,3-dione chemical structure")
2-[[(2R)-oxiran-2-yl]methyl]isoindole-1,3-dione
Catalog No: FT-0771783
CAS No: 181140-34-1
- Chemical Name: 2-[[(2R)-oxiran-2-yl]methyl]isoindole-1,3-dione
- Molecular Formula: C11H9NO3
- Molecular Weight: 203.19
- InChI Key: DUILGEYLVHGSEE-SSDOTTSWSA-N
- InChI: InChI=1S/C11H9NO3/c13-10-8-3-1-2-4-9(8)11(14)12(10)5-7-6-15-7/h1-4,7H,5-6H2/t7-/m1/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 181140-34-1 |
|---|---|
| MF: | C11H9NO3 |
| Density: | 1.4±0.1 g/cm3 |
| Flash_Point: | 163.9±20.4 °C |
| Melting_Point: | 101ºC |
| Product_Name: | (R)-(-)-Glycidyl phthalimide |
| Symbol: | GHS05 |
| Bolling_Point: | 347.4±15.0 °C at 760 mmHg |
| FW: | 203.194 |
| MF: | C11H9NO3 |
|---|---|
| Density: | 1.4±0.1 g/cm3 |
| More_Info: | ['1 . Melting point（ºC）101'] |
| Exact_Mass: | 203.058243 |
| Vapor_Pressure: | 0.0±0.8 mmHg at 25°C |
| Flash_Point: | 163.9±20.4 °C |
| PSA: | 58.70000 |
| Molecular_Structure: | ['1 . Molar refractive index 5116 ', '2 . Molar volume 1404 ', '3 . Parachor （902K）3981 ', '4 . Surface tension 645 ', '5 . Polarizability 2028'] |
| LogP: | 1.60 |
| Melting_Point: | 101ºC |
| Bolling_Point: | 347.4±15.0 °C at 760 mmHg |
| FW: | 203.194 |
| Refractive_Index: | 1.649 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Symbol: | GHS05 |
| Safety_Statements: | 26-39 |
| Warning_Statement: | P280-P305 + P351 + P338 |
| Hazard_Codes: | Xi |
| HS_Code: | 2925190090 |
| RIDADR: | NONH for all modes of transport |
| Risk_Statements(EU): | R41 |
