Bromazine Hydrochloride
Catalog No: FT-0663610
CAS No: 1808-12-4
- Chemical Name: Bromazine Hydrochloride
- Molecular Formula: C17H21BrClNO
- Molecular Weight: 370.7
- InChI Key: ZQDJSWUEGOYDGT-UHFFFAOYSA-N
- InChI: InChI=1S/C17H20BrNO.ClH/c1-19(2)12-13-20-17(14-6-4-3-5-7-14)15-8-10-16(18)11-9-15;/h3-11,17H,12-13H2,1-2H3;1H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 1808-12-4 |
| Flash_Point: | 194.1ºC |
| Product_Name: | bromazine hydrochloride |
| Bolling_Point: | 397.3ºC at 760 mmHg |
| FW: | 370.71200 |
| Melting_Point: | N/A |
| MF: | C17H21BrClNO |
| Density: | N/A |
| Vapor_Pressure: | 1.61E-06mmHg at 25°C |
|---|---|
| MF: | C17H21BrClNO |
| Flash_Point: | 194.1ºC |
| LogP: | 4.91870 |
| Bolling_Point: | 397.3ºC at 760 mmHg |
| FW: | 370.71200 |
| PSA: | 12.47000 |
| Exact_Mass: | 369.05000 |
| Symbol: | GHS07 |
|---|---|
| HS_Code: | 2922199090 |
| RIDADR: | NONH for all modes of transport |
| Warning_Statement: | P301 + P312 + P330 |
| Safety_Statements: | H302 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)