Methyl 4-chloro-2-pyridinecarboxylate hydrochloride
Catalog No: FT-0652358
CAS No: 176977-85-8
- Chemical Name: Methyl 4-chloro-2-pyridinecarboxylate hydrochloride
- Molecular Formula: C7H7Cl2NO2
- Molecular Weight: 208.04
- InChI Key: PAGFSBPYVNFHAS-UHFFFAOYSA-N
- InChI: InChI=1S/C7H6ClNO2.ClH/c1-11-7(10)6-4-5(8)2-3-9-6;/h2-4H,1H3;1H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 176977-85-8 |
| Flash_Point: | 113.5ºC |
| Product_Name: | methyl 4-chloropyridine-2-carboxylate,hydrochloride |
| Bolling_Point: | 264ºC at 760mmHg |
| FW: | 208.042 |
| Melting_Point: | 136-138ºC |
| MF: | C7H7Cl2NO2 |
| Density: | 1.294g/cm3 |
| Melting_Point: | 136-138ºC |
|---|---|
| Vapor_Pressure: | 0.000978mmHg at 25°C |
| MF: | C7H7Cl2NO2 |
| Flash_Point: | 113.5ºC |
| LogP: | 2.32360 |
| FW: | 208.042 |
| Density: | 1.294g/cm3 |
| PSA: | 39.19000 |
| Bolling_Point: | 264ºC at 760mmHg |
| Exact_Mass: | 206.985382 |
| Symbol: | GHS07 |
|---|---|
| HS_Code: | 2933399090 |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi |
| Warning_Statement: | P305 + P351 + P338 |
| Safety_Statements: | H319 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)