3-(2-Bromoacetyl)pyridine hydrobromide
Catalog No: FT-0611386
CAS No: 17694-68-7
- Chemical Name: 3-(2-Bromoacetyl)pyridine hydrobromide
- Molecular Formula: C7H7Br2NO
- Molecular Weight: 280.94
- InChI Key: WDTSYONULAZKIE-UHFFFAOYSA-N
- InChI: InChI=1S/C7H6BrNO.BrH/c8-4-7(10)6-2-1-3-9-5-6;/h1-3,5H,4H2;1H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 280.945 |
| Density: | N/A |
| CAS: | 17694-68-7 |
| Bolling_Point: | 275.9ºC at 760 mmHg |
| Product_Name: | 3-(Bromoacetyl)pyridinium bromide |
| Melting_Point: | 192ºC |
| Flash_Point: | 120.6ºC |
| MF: | C7H7Br2NO |
| LogP: | 2.61730 |
|---|---|
| Flash_Point: | 120.6ºC |
| Melting_Point: | 192ºC |
| FW: | 280.945 |
| PSA: | 29.96000 |
| MF: | C7H7Br2NO |
| Bolling_Point: | 275.9ºC at 760 mmHg |
| Vapor_Pressure: | 0.00497mmHg at 25°C |
| Exact_Mass: | 278.889435 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Hazard_Codes: | Xi: Irritant; |
| Risk_Statements(EU): | R36/37/38 |
| Safety_Statements: | S26 |
| Symbol: | Warning |
| Warning_Statement: | P261-P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933399090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)