Nicotiflorin
Catalog No: FT-0697835
CAS No: 17650-84-9
- Chemical Name: Nicotiflorin
- Molecular Formula: C27H30O15
- Molecular Weight: 594.5
- InChI Key: RTATXGUCZHCSNG-QHWHWDPRSA-N
- InChI: InChI=1S/C27H30O15/c1-9-17(31)20(34)22(36)26(39-9)38-8-15-18(32)21(35)23(37)27(41-15)42-25-19(33)16-13(30)6-12(29)7-14(16)40-24(25)10-2-4-11(28)5-3-10/h2-7,9,15,17-18,20-23,26-32,34-37H,8H2,1H3/t9-,15+,17-,18+,20+,21-,22+,23+,26+,27-/m0/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | kaempferol-3-rutinoside |
|---|---|
| Bolling_Point: | 941.7±65.0 °C at 760 mmHg |
| MF: | C27H30O15 |
| Symbol: | GHS07 |
| Melting_Point: | 181-186 ºC |
| CAS: | 17650-84-9 |
| Density: | 1.76 |
| FW: | 594.518 |
| Flash_Point: | 312.8±27.8 °C |
| Vapor_Pressure: | 0.0±0.3 mmHg at 25°C |
|---|---|
| Exact_Mass: | 594.158447 |
| Refractive_Index: | 1.744 |
| LogP: | 1.96 |
| Bolling_Point: | 941.7±65.0 °C at 760 mmHg |
| Density: | 1.76 |
| MF: | C27H30O15 |
| PSA: | 249.20000 |
| FW: | 594.518 |
| Flash_Point: | 312.8±27.8 °C |
| Melting_Point: | 181-186 ºC |
| Risk_Statements(EU): | 22 |
|---|---|
| Safety_Statements: | 22-45 |
| Symbol: | GHS07 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)