1-(4-FLUOROBENZYL)-4-(2-HYDROXYETHYL)PIPERAZINE
Catalog No: FT-0605708
CAS No: 174561-11-6
- Chemical Name: 1-(4-FLUOROBENZYL)-4-(2-HYDROXYETHYL)PIPERAZINE
- Molecular Formula: C13H19FN2O
- Molecular Weight: 238.3
- InChI Key: KCZHNDKCJQKXCG-UHFFFAOYSA-N
- InChI: InChI=1S/C13H19FN2O/c14-13-3-1-12(2-4-13)11-16-7-5-15(6-8-16)9-10-17/h1-4,17H,5-11H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 1-(4-fluorobenzyl)-4-(2-hydroxyethyl)piperazine |
|---|---|
| Flash_Point: | 169.1ºC |
| Melting_Point: | 55-56ºC |
| FW: | 238.30100 |
| Density: | 1.155g/cm3 |
| CAS: | 174561-11-6 |
| Bolling_Point: | 356ºC at 760 mmHg |
| MF: | C13H19FN2O |
| Density: | 1.155g/cm3 |
|---|---|
| LogP: | 0.81140 |
| Flash_Point: | 169.1ºC |
| Melting_Point: | 55-56ºC |
| FW: | 238.30100 |
| PSA: | 26.71000 |
| Exact_Mass: | 238.14800 |
| MF: | C13H19FN2O |
| Bolling_Point: | 356ºC at 760 mmHg |
| Vapor_Pressure: | 1.1E-05mmHg at 25°C |
| Refractive_Index: | 1.549 |
| Hazard_Codes: | Xi |
|---|---|
| HS_Code: | 2933599090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)