5-METHOXY-6-AZAINDOLE
Catalog No: FT-0652579
CAS No: 17288-53-8
- Chemical Name: 5-METHOXY-6-AZAINDOLE
- Molecular Formula: C8H8N2O
- Molecular Weight: 148.16
- InChI Key: CCNJNELOBGXDFD-UHFFFAOYSA-N
- InChI: InChI=1S/C8H8N2O/c1-11-8-4-6-2-3-9-7(6)5-10-8/h2-5,9H,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 132.163 |
| Density: | 1.2±0.1 g/cm3 |
| CAS: | 17288-53-8 |
| Bolling_Point: | 288.7±20.0 °C at 760 mmHg |
| Product_Name: | 5-Methoxy-1H-pyrrolo[2,3-c]pyridine |
| Melting_Point: | 122-127ºC |
| Flash_Point: | 129.4±13.1 °C |
| MF: | C8H8N2 |
| Density: | 1.2±0.1 g/cm3 |
|---|---|
| LogP: | 1.11 |
| Flash_Point: | 129.4±13.1 °C |
| Melting_Point: | 122-127ºC |
| FW: | 132.163 |
| PSA: | 37.91000 |
| Exact_Mass: | 132.068741 |
| MF: | C8H8N2 |
| Bolling_Point: | 288.7±20.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| Refractive_Index: | 1.667 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Hazard_Codes: | Xn: Harmful; |
| Risk_Statements(EU): | R22 |
| Safety_Statements: | H302 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933990090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)