Pent-2-ene-1,5-dioic acid
Catalog No: FT-0653171
CAS No: 1724-02-3
- Chemical Name: Pent-2-ene-1,5-dioic acid
- Molecular Formula: C5H6O4
- Molecular Weight: 130.10
- InChI Key: XVOUMQNXTGKGMA-OWOJBTEDSA-N
- InChI: InChI=1S/C5H6O4/c6-4(7)2-1-3-5(8)9/h1-2H,3H2,(H,6,7)(H,8,9)/b2-1+
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | trans-Glutaconic acid |
|---|---|
| Flash_Point: | 218.2±20.5 °C |
| Melting_Point: | 133-135ºC |
| FW: | 130.099 |
| Density: | 1.4±0.1 g/cm3 |
| CAS: | 1724-02-3 |
| Bolling_Point: | 413.8±28.0 °C at 760 mmHg |
| MF: | C5H6O4 |
| Density: | 1.4±0.1 g/cm3 |
|---|---|
| LogP: | 0.04 |
| Flash_Point: | 218.2±20.5 °C |
| Melting_Point: | 133-135ºC |
| FW: | 130.099 |
| PSA: | 74.60000 |
| Exact_Mass: | 130.026611 |
| MF: | C5H6O4 |
| Bolling_Point: | 413.8±28.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±2.1 mmHg at 25°C |
| Refractive_Index: | 1.517 |
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2917190090 |
| Safety_Statements: | S22-S24/25 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)