3-(2-Fluorophenyl)propionic acid
Catalog No: FT-0633730
CAS No: 1643-26-1
- Chemical Name: 3-(2-Fluorophenyl)propionic acid
- Molecular Formula: C9H9FO2
- Molecular Weight: 168.16
- InChI Key: GUZLQEOSDXLCKX-UHFFFAOYSA-N
- InChI: InChI=1S/C9H9FO2/c10-8-4-2-1-3-7(8)5-6-9(11)12/h1-4H,5-6H2,(H,11,12)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 168.165 |
| Density: | 1.2±0.1 g/cm3 |
| CAS: | 1643-26-1 |
| Bolling_Point: | 273.7±15.0 °C at 760 mmHg |
| Product_Name: | 3-(2-Fluorophenyl)propionic acid |
| Melting_Point: | 74-78ºC |
| Flash_Point: | 119.3±20.4 °C |
| MF: | C9H9FO2 |
| Density: | 1.2±0.1 g/cm3 |
|---|---|
| LogP: | 1.89 |
| Flash_Point: | 119.3±20.4 °C |
| Melting_Point: | 74-78ºC |
| FW: | 168.165 |
| PSA: | 37.30000 |
| Exact_Mass: | 168.058655 |
| MF: | C9H9FO2 |
| Bolling_Point: | 273.7±15.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| Refractive_Index: | 1.522 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
|---|---|
| Hazard_Codes: | Xn: Harmful; |
| Risk_Statements(EU): | R22;R36/37/38 |
| Safety_Statements: | S26 |
| Symbol: | Warning |
| Warning_Statement: | P261-P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2916399090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)