Menthyl isovalerate
Catalog No: FT-0650591
CAS No: 16409-46-4
- Chemical Name: Menthyl isovalerate
- Molecular Formula: C15H28O2
- Molecular Weight: 240.38
- InChI Key: VYQSSWZYPCCBRN-UHFFFAOYSA-N
- InChI: InChI=1S/C15H28O2/c1-10(2)8-15(16)17-14-9-12(5)6-7-13(14)11(3)4/h10-14H,6-9H2,1-5H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | 269.5ºC at 760mmHg |
|---|---|
| CAS: | 16409-46-4 |
| MF: | C15H28O2 |
| Melting_Point: | N/A |
| Symbol: | Warning |
| Density: | 0.909 |
| FW: | 240.38200 |
| Product_Name: | Menthyl isovalerate |
| Flash_Point: | 113ºC |
| Bolling_Point: | 269.5ºC at 760mmHg |
|---|---|
| MF: | C15H28O2 |
| Density: | 0.909 |
| Refractive_Index: | 1.452 |
| Exact_Mass: | 240.20900 |
| PSA: | 26.30000 |
| LogP: | 4.03650 |
| Flash_Point: | 113ºC |
| Vapor_Pressure: | 0.00724mmHg at 25°C |
| FW: | 240.38200 |
| WGK_Germany: | 2 |
|---|---|
| Symbol: | Warning |
| HS_Code: | 2915900090 |
| Safety_Statements: | H315-H319-H335 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| RTECS: | OT0720000 |
| Hazard_Codes: | Xi: Irritant; |
| RIDADR: | NONH for all modes of transport |
| Risk_Statements(EU): | R36/37/38 |
| Warning_Statement: | P261-P305 + P351 + P338 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)