1-(4-IODOPHENYL)-1H-PYRROLE-2-CARBALDEHYDE
Catalog No: FT-0605801
CAS No: 159325-84-5
- Chemical Name: 1-(4-IODOPHENYL)-1H-PYRROLE-2-CARBALDEHYDE
- Molecular Formula: C11H9N3O3
- Molecular Weight: 231.21
- InChI Key: YEOVCYIWTIZJMV-UHFFFAOYSA-N
- InChI: InChI=1S/C11H9N3O3/c1-5-9(6(2)15)10-8(14(5)16)4-3-7-11(10)13-17-12-7/h3-4,16H,1-2H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 1-(6-hydroxy-7-methylpyrrolo[2,3-g][2,1,3]benzoxadiazol-8-yl)ethanone |
|---|---|
| Flash_Point: | 247.2ºC |
| Melting_Point: | 301-303ºC |
| FW: | 231.20700 |
| Density: | 1.6g/cm3 |
| CAS: | 159325-84-5 |
| Bolling_Point: | 485.1ºC at 760mmHg |
| MF: | C11H9N3O3 |
| Density: | 1.6g/cm3 |
|---|---|
| LogP: | 1.92580 |
| Flash_Point: | 247.2ºC |
| Melting_Point: | 301-303ºC |
| FW: | 231.20700 |
| PSA: | 81.15000 |
| Exact_Mass: | 231.06400 |
| MF: | C11H9N3O3 |
| Bolling_Point: | 485.1ºC at 760mmHg |
| Vapor_Pressure: | 1.15E-05mmHg at 25°C |
| Refractive_Index: | 1.657 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| Safety_Statements: | S24/25 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)