![N,N-diethyl-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (CAS: 15421-84-8) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0763046.png "N,N-diethyl-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine chemical structure")
N,N-diethyl-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine
Catalog No: FT-0763046
CAS No: 15421-84-8
- Chemical Name: N,N-diethyl-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine
- Molecular Formula: C10H15N5
- Molecular Weight: 205.26
- InChI Key: GSNOZLZNQMLSKJ-UHFFFAOYSA-N
- InChI: InChI=1S/C10H15N5/c1-4-14(5-2)9-6-8(3)13-10-11-7-12-15(9)10/h6-7H,4-5H2,1-3H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| Flash_Point: | N/A |
| Density: | 1.2±0.1 g/cm3 |
| FW: | 205.260 |
| Bolling_Point: | N/A |
| MF: | C10H15N5 |
| Product_Name: | Trapidil |
| CAS: | 15421-84-8 |
| Melting_Point: | N/A |
| Refractive_Index: | 1.626 |
|---|---|
| FW: | 205.260 |
| LogP: | 1.45 |
| MF: | C10H15N5 |
| PSA: | 46.32000 |
| Density: | 1.2±0.1 g/cm3 |
| Exact_Mass: | 205.132751 |
| Warning_Statement: | P261-P305 + P351 + P338 |
|---|---|
| Symbol: | GHS07 |
| Safety_Statements: | H315-H319-H335 |
| HS_Code: | 2933990090 |
| RIDADR: | NONH for all modes of transport |
![5-AMINOPYRROLO[3,2-B]PYRIDINE (CAS: 207849-66-9) - Related Chemical Product](/static/img/prod_pic/FT-0603751.png "5-AMINOPYRROLO[3,2-B]PYRIDINE chemical structure")
![methyl 4-[amino-(3-chloropyrazin-2-yl)methyl]benzoate (CAS: 1620564-41-1) - Related Chemical Product](/static/img/prod_pic/FT-0768885.png "methyl 4-[amino-(3-chloropyrazin-2-yl)methyl]benzoate chemical structure")
