3-[5-(Chloromethyl)-1,2,4-oxadiazol-3-yl]pyridine
Catalog No: FT-0678971
CAS No: 15328-03-7
- Chemical Name: 3-[5-(Chloromethyl)-1,2,4-oxadiazol-3-yl]pyridine
- Molecular Formula: C8H6ClN3O
- Molecular Weight: 195.60
- InChI Key: RGRRKYQLLSVYGV-UHFFFAOYSA-N
- InChI: InChI=1S/C8H6ClN3O/c9-4-7-11-8(12-13-7)6-2-1-3-10-5-6/h1-3,5H,4H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 195.60600 |
| Density: | 1.35g/cm3 |
| CAS: | 15328-03-7 |
| Bolling_Point: | 350.3ºC at 760mmHg |
| Product_Name: | 3-[5-(Chloromethyl)-1,2,4-oxadiazol-3-yl]pyridine |
| Melting_Point: | N/A |
| Flash_Point: | 165.7ºC |
| MF: | C8H6ClN3O |
| Density: | 1.35g/cm3 |
|---|---|
| LogP: | 1.87040 |
| Flash_Point: | 165.7ºC |
| Refractive_Index: | 1.565 |
| FW: | 195.60600 |
| PSA: | 51.81000 |
| MF: | C8H6ClN3O |
| Bolling_Point: | 350.3ºC at 760mmHg |
| Vapor_Pressure: | 0mmHg at 25°C |
| Exact_Mass: | 195.02000 |
| Warning_Statement: | P280-P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H302-H318 |
| Symbol: | Danger |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2934999090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)