Cartap
Catalog No: FT-0658836
CAS No: 15263-53-3
- Chemical Name: Cartap
- Molecular Formula: C7H15N3O2S2
- Molecular Weight: 237.3
- InChI Key: IRUJZVNXZWPBMU-UHFFFAOYSA-N
- InChI: InChI=1S/C7H15N3O2S2/c1-10(2)5(3-13-6(8)11)4-14-7(9)12/h5H,3-4H2,1-2H3,(H2,8,11)(H2,9,12)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | -80ºC |
|---|---|
| CAS: | 15263-53-3 |
| MF: | C7H15N3O2S2 |
| Flash_Point: | 200.1±31.5 °C |
| Product_Name: | Cartap |
| Density: | 1.3±0.1 g/cm3 |
| FW: | 237.343 |
| Bolling_Point: | 407.2±55.0 °C at 760 mmHg |
| Refractive_Index: | 1.591 |
|---|---|
| Vapor_Pressure: | 0.0±0.9 mmHg at 25°C |
| Flash_Point: | 200.1±31.5 °C |
| LogP: | 0.53 |
| Bolling_Point: | 407.2±55.0 °C at 760 mmHg |
| FW: | 237.343 |
| PSA: | 140.02000 |
| Melting_Point: | -80ºC |
| MF: | C7H15N3O2S2 |
| Exact_Mass: | 237.060562 |
| Density: | 1.3±0.1 g/cm3 |
| Safety_Statements: | 60-61 |
|---|---|
| Hazard_Codes: | N: Dangerous for the environment; |
| HS_Code: | 2930909054 |
| Risk_Statements(EU): | R50/53 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)