SB-203580
Catalog No: FT-0674525
CAS No: 152121-47-6
- Chemical Name: SB-203580
- Molecular Formula: C21H16FN3OS
- Molecular Weight: 377.4
- InChI Key: CDMGBJANTYXAIV-UHFFFAOYSA-N
- InChI: InChI=1S/C21H16FN3OS/c1-27(26)18-8-4-16(5-9-18)21-24-19(14-2-6-17(22)7-3-14)20(25-21)15-10-12-23-13-11-15/h2-13H,1H3,(H,24,25)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | 615.6±55.0 °C at 760 mmHg |
|---|---|
| CAS: | 152121-47-6 |
| MF: | C21H16FN3OS |
| Melting_Point: | 249 - 250ºC |
| Symbol: | Danger |
| Density: | 1.4±0.1 g/cm3 |
| FW: | 377.435 |
| Product_Name: | SB 203580 |
| Flash_Point: | 326.1±31.5 °C |
| Bolling_Point: | 615.6±55.0 °C at 760 mmHg |
|---|---|
| LogP: | 4.10 |
| Vapor_Pressure: | 0.0±1.7 mmHg at 25°C |
| Density: | 1.4±0.1 g/cm3 |
| Melting_Point: | 249 - 250ºC |
| Exact_Mass: | 377.099823 |
| MF: | C21H16FN3OS |
| Refractive_Index: | 1.715 |
| PSA: | 77.85000 |
| Flash_Point: | 326.1±31.5 °C |
| FW: | 377.435 |
| Symbol: | Danger |
|---|---|
| HS_Code: | 2818200000 |
| Safety_Statements: | 26-39 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| Warning_Statement: | P280-P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
| Risk_Statements(EU): | R22;R41 |
| Hazard_Codes: | Xn: Harmful; |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)