Ipronidazole
Catalog No: FT-0670410
CAS No: 14885-29-1
- Chemical Name: Ipronidazole
- Molecular Formula: C7H11N3O2
- Molecular Weight: 169.18
- InChI Key: NTAFJUSDNOSFFY-UHFFFAOYSA-N
- InChI: InChI=1S/C7H11N3O2/c1-5(2)7-8-4-6(9(7)3)10(11)12/h4-5H,1-3H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 169.181 |
| Density: | 1.3±0.1 g/cm3 |
| CAS: | 14885-29-1 |
| Bolling_Point: | 309.3±15.0 °C at 760 mmHg |
| Product_Name: | ipronidazole |
| Melting_Point: | N/A |
| Flash_Point: | 140.9±20.4 °C |
| MF: | C7H11N3O2 |
| Density: | 1.3±0.1 g/cm3 |
|---|---|
| LogP: | 1.18 |
| Flash_Point: | 140.9±20.4 °C |
| Refractive_Index: | 1.572 |
| FW: | 169.181 |
| PSA: | 63.64000 |
| MF: | C7H11N3O2 |
| Bolling_Point: | 309.3±15.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| Exact_Mass: | 169.085129 |
| Symbol: | GHS07 |
|---|---|
| Safety_Statements: | H302 |
| HS_Code: | 2933290090 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)