Indole-6-boronic acid
Catalog No: FT-0651525
CAS No: 147621-18-9
- Chemical Name: Indole-6-boronic acid
- Molecular Formula: C8H8BNO2
- Molecular Weight: 160.97
- InChI Key: ZVMHOIWRCCZGPZ-UHFFFAOYSA-N
- InChI: InChI=1S/C8H8BNO2/c11-9(12)7-2-1-6-3-4-10-8(6)5-7/h1-5,10-12H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 147621-18-9 |
| Flash_Point: | 215.8±26.5 °C |
| Product_Name: | Indole-6-boronic acid |
| Bolling_Point: | 433.2±37.0 °C at 760 mmHg |
| FW: | 160.966 |
| Melting_Point: | 177-181ºC |
| MF: | C8H8BNO2 |
| Density: | 1.3±0.1 g/cm3 |
| Melting_Point: | 177-181ºC |
|---|---|
| Refractive_Index: | 1.662 |
| Vapor_Pressure: | 0.0±1.1 mmHg at 25°C |
| MF: | C8H8BNO2 |
| Flash_Point: | 215.8±26.5 °C |
| LogP: | 1.51 |
| FW: | 160.966 |
| Density: | 1.3±0.1 g/cm3 |
| PSA: | 56.25000 |
| Bolling_Point: | 433.2±37.0 °C at 760 mmHg |
| Exact_Mass: | 161.064804 |
| Symbol: | GHS07 |
|---|---|
| Risk_Statements(EU): | R36/37/38 |
| HS_Code: | 2933990090 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi:Irritant; |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H315-H319-H335 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)