![(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-4-methylsulfanylbutanoic acid (CAS: 14486-09-0) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0772541.png "(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-4-methylsulfanylbutanoic acid chemical structure")
(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-4-methylsulfanylbutanoic acid
Catalog No: FT-0772541
CAS No: 14486-09-0
- Chemical Name: (2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-4-methylsulfanylbutanoic acid
- Molecular Formula: C10H20N2O3S
- Molecular Weight: 248.34
- InChI Key: YSGSDAIMSCVPHG-YUMQZZPRSA-N
- InChI: InChI=1S/C10H20N2O3S/c1-6(2)8(11)9(13)12-7(10(14)15)4-5-16-3/h6-8H,4-5,11H2,1-3H3,(H,12,13)(H,14,15)/t7-,8-/m0/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | 486.8ºC at 760 mmHg |
|---|---|
| MF: | C10H20N2O3S |
| Density: | 1.166g/cm3 |
| Product_Name: | 2-[(2-amino-3-methylbutanoyl)amino]-4-methylsulfanylbutanoic acid |
| FW: | 248.34200 |
| CAS: | 14486-09-0 |
| Flash_Point: | 248.2ºC |
| Melting_Point: | N/A |
| Bolling_Point: | 486.8ºC at 760 mmHg |
|---|---|
| MF: | C10H20N2O3S |
| Density: | 1.166g/cm3 |
| FW: | 248.34200 |
| Exact_Mass: | 248.11900 |
| PSA: | 117.72000 |
| LogP: | 1.38340 |
| Flash_Point: | 248.2ºC |
| Vapor_Pressure: | 8.29E-11mmHg at 25°C |
| Refractive_Index: | 1.522 |
| HS_Code: | 2930909090 |
|---|---|
| RIDADR: | NONH for all modes of transport |
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-