3'-IODOACETOPHENONE
Catalog No: FT-0615890
CAS No: 14452-30-3
- Chemical Name: 3'-IODOACETOPHENONE
- Molecular Formula: C8H7IO
- Molecular Weight: 246.04
- InChI Key: IWLHOUBDKCKJJQ-UHFFFAOYSA-N
- InChI: InChI=1S/C8H7IO/c1-6(10)7-3-2-4-8(9)5-7/h2-5H,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 1-(3-Iodophenyl)ethanone |
|---|---|
| Bolling_Point: | 284.3±23.0 °C at 760 mmHg |
| MF: | C8H7IO |
| Symbol: | GHS05, GHS07 |
| Melting_Point: | N/A |
| CAS: | 14452-30-3 |
| Density: | 1.7±0.1 g/cm3 |
| FW: | 246.045 |
| Flash_Point: | 125.7±22.6 °C |
| Exact_Mass: | 245.954147 |
|---|---|
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| MF: | C8H7IO |
| LogP: | 2.90 |
| Bolling_Point: | 284.3±23.0 °C at 760 mmHg |
| Density: | 1.7±0.1 g/cm3 |
| PSA: | 17.07000 |
| FW: | 246.045 |
| Flash_Point: | 125.7±22.6 °C |
| Refractive_Index: | 1.604 |
| Risk_Statements(EU): | R36/37/38 |
|---|---|
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| Safety_Statements: | H302-H318 |
| HS_Code: | 2914700090 |
| Warning_Statement: | P280-P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
| Symbol: | GHS05, GHS07 |
| Hazard_Codes: | Xi,C,Xn |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)