Eprosartan mesylate
Catalog No: FT-0653173
CAS No: 144143-96-4
- Chemical Name: Eprosartan mesylate
- Molecular Formula: C24H28N2O7S2
- Molecular Weight: 520.6
- InChI Key: DJSLTDBPKHORNY-XMMWENQYSA-N
- InChI: InChI=1S/C23H24N2O4S.CH4O3S/c1-2-3-6-21-24-14-19(12-18(23(28)29)13-20-5-4-11-30-20)25(21)15-16-7-9-17(10-8-16)22(26)27;1-5(2,3)4/h4-5,7-12,14H,2-3,6,13,15H2,1H3,(H,26,27)(H,28,29);1H3,(H,2,3,4)/b18-12+;
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 144143-96-4 |
| Flash_Point: | 353.3ºC |
| Product_Name: | Eprosartan mesylate |
| Bolling_Point: | 660.6ºC |
| FW: | 520.618 |
| Melting_Point: | N/A |
| MF: | C24H28N2O7S2 |
| Density: | 1.26 g/cm3 |
| Vapor_Pressure: | 2.37E-18mmHg at 25°C |
|---|---|
| MF: | C24H28N2O7S2 |
| Flash_Point: | 353.3ºC |
| LogP: | 5.32920 |
| FW: | 520.618 |
| Density: | 1.26 g/cm3 |
| PSA: | 183.41000 |
| Bolling_Point: | 660.6ºC |
| Exact_Mass: | 520.133789 |
| Symbol: | GHS07 |
|---|---|
| HS_Code: | 2934999090 |
| RIDADR: | NONH for all modes of transport |
| Warning_Statement: | P305 + P351 + P338 |
| Safety_Statements: | H315-H319 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)