4-(2-BROMOETHYL)PHENOL
Catalog No: FT-0637016
CAS No: 14140-15-9
- Chemical Name: 4-(2-BROMOETHYL)PHENOL
- Molecular Formula: C8H9BrO
- Molecular Weight: 201.06
- InChI Key: DYYVTFCYVZEQDG-UHFFFAOYSA-N
- InChI: InChI=1S/C8H9BrO/c9-6-5-7-1-3-8(10)4-2-7/h1-4,10H,5-6H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | 276.5±15.0 °C at 760 mmHg |
|---|---|
| CAS: | 14140-15-9 |
| MF: | C8H9BrO |
| Melting_Point: | 88-92ºC(lit.) |
| Symbol: | Warning |
| Density: | 1.5±0.1 g/cm3 |
| FW: | 201.061 |
| Product_Name: | 4-(2-Bromoethyl)phenol |
| Flash_Point: | 121.1±20.4 °C |
| Exact_Mass: | 199.983673 |
|---|---|
| MF: | C8H9BrO |
| Density: | 1.5±0.1 g/cm3 |
| FW: | 201.061 |
| Refractive_Index: | 1.594 |
| Bolling_Point: | 276.5±15.0 °C at 760 mmHg |
| PSA: | 20.23000 |
| LogP: | 2.35 |
| Flash_Point: | 121.1±20.4 °C |
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| Melting_Point: | 88-92ºC(lit.) |
| Symbol: | Warning |
|---|---|
| Safety_Statements: | 26-37/39 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| Warning_Statement: | P261-P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
| Risk_Statements(EU): | R36/37/38 |
| Hazard_Codes: | Xi: Irritant; |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)