3-Amino-4,5-dimethylisoxazole
Catalog No: FT-0645806
CAS No: 13999-39-8
- Chemical Name: 3-Amino-4,5-dimethylisoxazole
- Molecular Formula: C5H8N2O
- Molecular Weight: 112.13
- InChI Key: VPANVNSDJSUFEF-UHFFFAOYSA-N
- InChI: InChI=1S/C5H8N2O/c1-3-4(2)8-7-5(3)6/h1-2H3,(H2,6,7)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | 250.0±35.0 °C at 760 mmHg |
|---|---|
| CAS: | 13999-39-8 |
| MF: | C5H8N2O |
| Melting_Point: | N/A |
| Symbol: | Warning |
| Density: | 1.1±0.1 g/cm3 |
| FW: | 112.130 |
| Product_Name: | 4,5-Dimethyl-1,2-oxazol-3-amine |
| Flash_Point: | 105.0±25.9 °C |
| Bolling_Point: | 250.0±35.0 °C at 760 mmHg |
|---|---|
| MF: | C5H8N2O |
| Density: | 1.1±0.1 g/cm3 |
| Refractive_Index: | 1.521 |
| Exact_Mass: | 112.063660 |
| PSA: | 52.05000 |
| LogP: | -0.28 |
| Flash_Point: | 105.0±25.9 °C |
| Vapor_Pressure: | 0.0±0.5 mmHg at 25°C |
| FW: | 112.130 |
| Symbol: | Warning |
|---|---|
| HS_Code: | 2934999090 |
| Safety_Statements: | H302 |
| Hazard_Codes: | Xi: Irritant; |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)