N-(CHLOROACETYL)ALLYLAMINE
Catalog No: FT-0602619
CAS No: 13269-97-1
- Chemical Name: N-(CHLOROACETYL)ALLYLAMINE
- Molecular Formula: C5H8ClNO
- Molecular Weight: 133.57
- InChI Key: AZOOMRDAGOXGNJ-UHFFFAOYSA-N
- InChI: InChI=1S/C5H8ClNO/c1-2-3-7-5(8)4-6/h2H,1,3-4H2,(H,7,8)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | N/A |
|---|---|
| CAS: | 13269-97-1 |
| MF: | C5H8ClNO |
| Flash_Point: | 117.3ºC |
| Product_Name: | 2-chloro-N-prop-2-enylacetamide |
| Density: | 1.081g/cm3 |
| FW: | 133.57600 |
| Bolling_Point: | 270.3ºC at 760mmHg |
| Refractive_Index: | 1.453 |
|---|---|
| Vapor_Pressure: | 0.00688mmHg at 25°C |
| MF: | C5H8ClNO |
| Flash_Point: | 117.3ºC |
| LogP: | 0.91830 |
| FW: | 133.57600 |
| Density: | 1.081g/cm3 |
| PSA: | 29.10000 |
| Bolling_Point: | 270.3ºC at 760mmHg |
| Exact_Mass: | 133.02900 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| HS_Code: | 2924199090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)