![[(5-Methyl-2-phenyl-1,3-oxazol-4-yl)methyl]amine (CAS: 132451-28-6) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0679375.png "[(5-Methyl-2-phenyl-1,3-oxazol-4-yl)methyl]amine chemical structure")
[(5-Methyl-2-phenyl-1,3-oxazol-4-yl)methyl]amine
Catalog No: FT-0679375
CAS No: 132451-28-6
- Chemical Name: [(5-Methyl-2-phenyl-1,3-oxazol-4-yl)methyl]amine
- Molecular Formula: C11H12N2O
- Molecular Weight: 188.23
- InChI Key: LEKZZMAVLLJSNA-UHFFFAOYSA-N
- InChI: InChI=1S/C11H12N2O/c1-8-10(7-12)13-11(14-8)9-5-3-2-4-6-9/h2-6H,7,12H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | (5-methyl-2-phenyl-1,3-oxazol-4-yl)methanamine |
|---|---|
| Flash_Point: | 161.6ºC |
| Melting_Point: | 42ºC |
| FW: | 188.22600 |
| Density: | 1.127g/cm3 |
| CAS: | 132451-28-6 |
| Bolling_Point: | 343.6ºC at 760mmHg |
| MF: | C11H12N2O |
| Density: | 1.127g/cm3 |
|---|---|
| LogP: | 2.80900 |
| Flash_Point: | 161.6ºC |
| Melting_Point: | 42ºC |
| FW: | 188.22600 |
| PSA: | 52.05000 |
| Exact_Mass: | 188.09500 |
| MF: | C11H12N2O |
| Bolling_Point: | 343.6ºC at 760mmHg |
| Vapor_Pressure: | 6.98E-05mmHg at 25°C |
| Refractive_Index: | 1.566 |
| HS_Code: | 2934999090 |
|---|
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)