5-Bromo-4-chloro-3-indolyl-N-acetyl-beta-D-galactosaminide
Catalog No: FT-0629800
CAS No: 129572-48-1
- Chemical Name: 5-Bromo-4-chloro-3-indolyl-N-acetyl-beta-D-galactosaminide
- Molecular Formula: C16H18BrClN2O6
- Molecular Weight: 449.7
- InChI Key: SUWPNTKTZYIFQT-LMXXTMHSSA-N
- InChI: InChI=1S/C16H18BrClN2O6/c1-6(22)20-13-15(24)14(23)10(5-21)26-16(13)25-9-4-19-8-3-2-7(17)12(18)11(8)9/h2-4,10,13-16,19,21,23-24H,5H2,1H3,(H,20,22)/t10-,13-,14+,15-,16-/m1/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 5-Bromo-4-chloro-3-indolyl-N-acetyl-β-D-galactosaminide |
|---|---|
| Flash_Point: | 424.0±32.9 °C |
| Melting_Point: | 220ºC(lit.) |
| FW: | 449.681 |
| Density: | 1.8±0.1 g/cm3 |
| CAS: | 129572-48-1 |
| Bolling_Point: | 777.5±60.0 °C at 760 mmHg |
| MF: | C16H18BrClN2O6 |
| Density: | 1.8±0.1 g/cm3 |
|---|---|
| LogP: | 1.39 |
| Flash_Point: | 424.0±32.9 °C |
| Melting_Point: | 220ºC(lit.) |
| FW: | 449.681 |
| PSA: | 124.04000 |
| Exact_Mass: | 448.003662 |
| MF: | C16H18BrClN2O6 |
| Bolling_Point: | 777.5±60.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±2.8 mmHg at 25°C |
| Refractive_Index: | 1.702 |
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR: | NONH for all modes of transport |
| WGK_Germany: | 3 |