I-BUT-CYS-OH
Catalog No: FT-0643028
CAS No: 124529-02-8
- Chemical Name: I-BUT-CYS-OH
- Molecular Formula: C7H13NO3S
- Molecular Weight: 191.25
- InChI Key: BWBQXMAXLAHHTK-YFKPBYRVSA-N
- InChI: InChI=1S/C7H13NO3S/c1-4(2)6(9)8-5(3-12)7(10)11/h4-5,12H,3H2,1-2H3,(H,8,9)(H,10,11)/t5-/m0/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | 97-101ºC |
|---|---|
| CAS: | 124529-02-8 |
| MF: | C7H13NO3S |
| Flash_Point: | 196.7ºC |
| Product_Name: | (2R)-2-(2-methylpropanoylamino)-3-sulfanylpropanoic acid |
| Density: | 1.199g/cm3 |
| FW: | 191.24800 |
| Bolling_Point: | 401.6ºC at 760mmHg |
| Melting_Point: | 97-101ºC |
|---|---|
| Refractive_Index: | 1.507 |
| Vapor_Pressure: | 1.42E-07mmHg at 25°C |
| MF: | C7H13NO3S |
| Flash_Point: | 196.7ºC |
| LogP: | 0.53250 |
| FW: | 191.24800 |
| Density: | 1.199g/cm3 |
| PSA: | 105.20000 |
| Bolling_Point: | 401.6ºC at 760mmHg |
| Exact_Mass: | 191.06200 |
| RIDADR: | NONH for all modes of transport |
|---|---|
| HS_Code: | 2930909090 |
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)