![5-Bromo-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid (CAS: 1222175-20-3) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0682891.png "5-Bromo-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid chemical structure")
5-Bromo-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid
Catalog No: FT-0682891
CAS No: 1222175-20-3
- Chemical Name: 5-Bromo-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid
- Molecular Formula: C8H5BrN2O2
- Molecular Weight: 241.04
- InChI Key: WVRNTDOWZRUIKE-UHFFFAOYSA-N
- InChI: InChI=1S/C8H5BrN2O2/c9-5-1-4-2-6(8(12)13)11-7(4)10-3-5/h1-3H,(H,10,11)(H,12,13)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 241.042 |
| Density: | 1.9±0.1 g/cm3 |
| CAS: | 1222175-20-3 |
| Bolling_Point: | 468.7±40.0 °C at 760 mmHg |
| Product_Name: | 5-Bromo-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid |
| Melting_Point: | N/A |
| Flash_Point: | 237.3±27.3 °C |
| MF: | C8H5BrN2O2 |
| Density: | 1.9±0.1 g/cm3 |
|---|---|
| LogP: | 3.02 |
| Flash_Point: | 237.3±27.3 °C |
| Refractive_Index: | 1.766 |
| FW: | 241.042 |
| PSA: | 65.98000 |
| MF: | C8H5BrN2O2 |
| Bolling_Point: | 468.7±40.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±1.2 mmHg at 25°C |
| Exact_Mass: | 239.953430 |
| Warning_Statement: | P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H319 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933990090 |
