2-Aminoethyldiisopropylamine
Catalog No: FT-0608789
CAS No: 121-05-1
- Chemical Name: 2-Aminoethyldiisopropylamine
- Molecular Formula: C8H20N2
- Molecular Weight: 144.26
- InChI Key: CURJNMSGPBXOGK-UHFFFAOYSA-N
- InChI: InChI=1S/C8H20N2/c1-7(2)10(6-5-9)8(3)4/h7-8H,5-6,9H2,1-4H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | N,N-Diisopropylethylenediamine |
|---|---|
| Bolling_Point: | 162.8±8.0 °C at 760 mmHg |
| Density: | 0.8±0.1 g/cm3 |
| MF: | C8H20N2 |
| CAS: | 121-05-1 |
| Melting_Point: | N/A |
| Flash_Point: | 49.3±13.1 °C |
| FW: | 144.258 |
| MF: | C8H20N2 |
|---|---|
| Bolling_Point: | 162.8±8.0 °C at 760 mmHg |
| Exact_Mass: | 144.162643 |
| PSA: | 24.06000 |
| Flash_Point: | 49.3±13.1 °C |
| Computational_Chemistry: | ['1. XlogP :09 ', '2. Hydrogen Bond Donor Count :1 ', '3. Hydrogen Bond Acceptor Count :2 ', '4. Rotatable Bond Count :4 ', '5. Isotope Atom Count :N/A ', '6. TPSA 293 ', '7. Heavy Atom Count :10 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :713 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| Density: | 0.8±0.1 g/cm3 |
| Molecular_Structure: | ['1 . Molar refractive index 4628 ', '2 . Molar volume 1722 ', '3 . Parachor (902K)3999 ', '4 . Surface tension 290 ', '5 . Dielectric constant ', '6 偶极距(10-24cm3) ', '7 . Polarizability 1834'] |
| Vapor_Pressure: | 2.1±0.3 mmHg at 25°C |
| FW: | 144.258 |
| LogP: | 0.90 |
| Refractive_Index: | 1.450 |
| Risk_Statements(EU): | R10;R37/38 |
|---|---|
| HS_Code: | 2921219000 |
| Hazard_Codes: | Xi:Irritant; |
| RTECS: | KV4200000 |
| Hazard_Class: | 8 |
| Packing_Group: | II |
| WGK_Germany: | 3 |
| Safety_Statements: | S16-S26-S27-S36/37/39-S45-S28-S23 |
| RIDADR: | UN 2733 3/PG 3 |