![1-furo[3,2-b]pyridin-6-ylethanone (CAS: 1203499-00-6) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0766756.png "1-furo[3,2-b]pyridin-6-ylethanone chemical structure")
1-furo[3,2-b]pyridin-6-ylethanone
Catalog No: FT-0766756
CAS No: 1203499-00-6
- Chemical Name: 1-furo[3,2-b]pyridin-6-ylethanone
- Molecular Formula: C9H7NO2
- Molecular Weight: 161.16
- InChI Key: IYGXFOJTFQFSMM-UHFFFAOYSA-N
- InChI: InChI=1S/C9H7NO2/c1-6(11)7-4-9-8(10-5-7)2-3-12-9/h2-5H,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 1203499-00-6 |
|---|---|
| MF: | C9H7NO2 |
| Density: | N/A |
| Flash_Point: | N/A |
| Melting_Point: | N/A |
| Product_Name: | 1-furo[3,2-b]pyridin-6-ylethanone |
| Symbol: | GHS07 |
| Bolling_Point: | N/A |
| FW: | 161.15700 |
| Exact_Mass: | 161.04800 |
|---|---|
| MF: | C9H7NO2 |
| LogP: | 2.03040 |
| PSA: | 43.10000 |
| FW: | 161.15700 |
| Symbol: | GHS07 |
|---|---|
| HS_Code: | 2934999090 |
| RIDADR: | NONH for all modes of transport |
| Safety_Statements: | H302 |
