![methyl 6H-thieno[2,3-b]pyrrole-5-carboxylate (CAS: 118465-49-9) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0745281.png "methyl 6H-thieno[2,3-b]pyrrole-5-carboxylate chemical structure")
methyl 6H-thieno[2,3-b]pyrrole-5-carboxylate
Catalog No: FT-0745281
CAS No: 118465-49-9
- Chemical Name: methyl 6H-thieno[2,3-b]pyrrole-5-carboxylate
- Molecular Formula: C8H7NO2S
- Molecular Weight: 181.21
- InChI Key: YBIAQTPXONLBJG-UHFFFAOYSA-N
- InChI: InChI=1S/C8H7NO2S/c1-11-8(10)6-4-5-2-3-12-7(5)9-6/h2-4,9H,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | 336.8ºC at 760 mmHg |
|---|---|
| CAS: | 118465-49-9 |
| MF: | C8H7NO2S |
| Density: | 1.402g/cm3 |
| Melting_Point: | 127ºC |
| Product_Name: | methyl 6H-thieno[2,3-b]pyrrole-5-carboxylate |
| Flash_Point: | 157.5ºC |
| FW: | 181.21200 |
| Bolling_Point: | 336.8ºC at 760 mmHg |
|---|---|
| Density: | 1.402g/cm3 |
| MF: | C8H7NO2S |
| LogP: | 2.01600 |
| Melting_Point: | 127ºC |
| Exact_Mass: | 181.02000 |
| Vapor_Pressure: | 0.000109mmHg at 25°C |
| Flash_Point: | 157.5ºC |
| FW: | 181.21200 |
| Refractive_Index: | 1.677 |
| PSA: | 70.33000 |
| HS_Code: | 2934999090 |
|---|
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)