5,6-Dimethylxantheonone-4-acetic acid
Catalog No: FT-0630255
CAS No: 117570-53-3
- Chemical Name: 5,6-Dimethylxantheonone-4-acetic acid
- Molecular Formula: C17H14O4
- Molecular Weight: 282.29
- InChI Key: XGOYIMQSIKSOBS-UHFFFAOYSA-N
- InChI: InChI=1S/C17H14O4/c1-9-6-7-13-15(20)12-5-3-4-11(8-14(18)19)17(12)21-16(13)10(9)2/h3-7H,8H2,1-2H3,(H,18,19)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07, GHS09 |
|---|---|
| CAS: | 117570-53-3 |
| Flash_Point: | 197.1±23.6 °C |
| Product_Name: | DMXAA |
| Bolling_Point: | 520.9±50.0 °C at 760 mmHg |
| FW: | 282.291 |
| Melting_Point: | N/A |
| MF: | C17H14O4 |
| Density: | 1.3±0.1 g/cm3 |
| Refractive_Index: | 1.633 |
|---|---|
| Vapor_Pressure: | 0.0±1.4 mmHg at 25°C |
| MF: | C17H14O4 |
| Flash_Point: | 197.1±23.6 °C |
| LogP: | 3.60 |
| FW: | 282.291 |
| Density: | 1.3±0.1 g/cm3 |
| PSA: | 67.51000 |
| Bolling_Point: | 520.9±50.0 °C at 760 mmHg |
| Computational_Chemistry: | ['1. XlogP :32 ', '2. Hydrogen Bond Donor Count :1 ', '3. Hydrogen Bond Acceptor Count :4 ', '4. Rotatable Bond Count :2 ', '5. Isotope Atom Count :5 ', '6. TPSA :636 ', '7. Heavy Atom Count :21 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :433 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| Exact_Mass: | 282.089203 |
| Symbol: | GHS07, GHS09 |
|---|---|
| RIDADR: | UN 3077 |
| HS_Code: | 2932999099 |
| Risk_Statements(EU): | R22;R50/53 |
| WGK_Germany: | 3 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| RTECS: | ZD5536200 |
| Hazard_Codes: | Xn: Harmful;N: Dangerous for the environment; |
| Warning_Statement: | P273 |
| Safety_Statements: | H302-H400 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)