![3,4-Dimethoxy[7-13C]-benzaldehyde (CAS: 1173022-44-0) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0667232.png "3,4-Dimethoxy[7-13C]-benzaldehyde chemical structure")
3,4-Dimethoxy[7-13C]-benzaldehyde
Catalog No: FT-0667232
CAS No: 1173022-44-0
- Chemical Name: 3,4-Dimethoxy[7-13C]-benzaldehyde
- Molecular Formula: C9H10O3
- Molecular Weight: 167.17
- InChI Key: WJUFSDZVCOTFON-PTQBSOBMSA-N
- InChI: InChI=1S/C9H10O3/c1-11-8-4-3-7(6-10)5-9(8)12-2/h3-6H,1-2H3/i6+1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 167.16700 |
| Density: | N/A |
| CAS: | 1173022-44-0 |
| Bolling_Point: | N/A |
| Product_Name: | 3,4-dimethoxybenzaldehyde |
| Melting_Point: | N/A |
| Flash_Point: | >113 °C |
| MF: | C9H10O3 |
| LogP: | 1.51630 |
|---|---|
| PSA: | 35.53000 |
| MF: | C9H10O3 |
| FW: | 167.16700 |
| Exact_Mass: | 167.06600 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
|---|---|
| Flash_Point_(C): | >113 °C |
| Warning_Statement: | P280-P305 + P351 + P338 |
| Safety_Statements: | H302-H315-H317-H319 |
| Symbol: | Warning |
| Flash_Point_(F): | >235.4 °F |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)