6-BROMO-2-CHLORO-3-METHYLQUINOLINE
Catalog No: FT-0620971
CAS No: 113092-96-9
- Molecular Formula: 256.52
- Formula Weight: C10H7BrClN
- Inchl Key: VKGSTGZYRFTWNA-UHFFFAOYSA-N
- Inchl: InChI=1S/C10H7BrClN/c1-6-4-7-5-8(11)2-3-9(7)13-10(6)12/h2-5H,1H3
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS05, GHS07 |
|---|---|
| CAS: | 113092-96-9 |
| Flash_Point: | 160.8ºC |
| Product_Name: | 6-Bromo-2-chloro-3-methylquinoline |
| Bolling_Point: | 342.2ºC at 760 mmHg |
| FW: | 256.52600 |
| Melting_Point: | N/A |
| MF: | C10H7BrClN |
| Density: | 1.591g/cm3 |
| Refractive_Index: | 1.661 |
|---|---|
| Vapor_Pressure: | 0.000151mmHg at 25°C |
| MF: | C10H7BrClN |
| Flash_Point: | 160.8ºC |
| LogP: | 3.95910 |
| FW: | 256.52600 |
| Density: | 1.591g/cm3 |
| PSA: | 12.89000 |
| Bolling_Point: | 342.2ºC at 760 mmHg |
| Exact_Mass: | 254.94500 |
| Symbol: | GHS05, GHS07 |
|---|---|
| HS_Code: | 2933499090 |
| RIDADR: | NONH for all modes of transport |
| Warning_Statement: | P280-P305 + P351 + P338 |
| Safety_Statements: | H302-H318-H413 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)