1-[3-(BROMOMETHYL)PHENYL]-1H-PYRROLE
Catalog No: FT-0607109
CAS No: 112596-36-8
- Chemical Name: 1-[3-(BROMOMETHYL)PHENYL]-1H-PYRROLE
- Molecular Formula: C11H10BrN
- Molecular Weight: 236.11
- InChI Key: YMWNCAQFJODGRZ-UHFFFAOYSA-N
- InChI: InChI=1S/C11H10BrN/c12-9-10-4-3-5-11(8-10)13-6-1-2-7-13/h1-8H,9H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 1-[3-(bromomethyl)phenyl]pyrrole |
|---|---|
| Flash_Point: | 150.7ºC |
| Melting_Point: | 54ºC |
| FW: | 236.10800 |
| Density: | 1.34g/cm3 |
| CAS: | 112596-36-8 |
| Bolling_Point: | 325.6ºC at 760mmHg |
| MF: | C11H10BrN |
| Density: | 1.34g/cm3 |
|---|---|
| LogP: | 3.37220 |
| Flash_Point: | 150.7ºC |
| Melting_Point: | 54ºC |
| FW: | 236.10800 |
| PSA: | 4.93000 |
| Exact_Mass: | 235.00000 |
| MF: | C11H10BrN |
| Bolling_Point: | 325.6ºC at 760mmHg |
| Vapor_Pressure: | 0.000432mmHg at 25°C |
| Refractive_Index: | 1.593 |
| Hazard_Codes: | C: Corrosive; |
|---|---|
| Risk_Statements(EU): | R34 |
| HS_Code: | 2933990090 |