4-nitropyridine
Catalog No: FT-0692561
CAS No: 1122-61-8
- Molecular Formula: 124.1
- Formula Weight: C5H4N2O2
- Inchl Key: FEXIEMAAKBNTFK-UHFFFAOYSA-N
- Inchl: InChI=1S/C5H4N2O2/c8-7(9)5-1-3-6-4-2-5/h1-4H
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | 51-54 °C(lit.) |
|---|---|
| CAS: | 1122-61-8 |
| MF: | C5H4N2O2 |
| Flash_Point: | 93.6±19.8 °C |
| Product_Name: | 4-Nitropyridine |
| Density: | 1.3±0.1 g/cm3 |
| FW: | 124.098 |
| Bolling_Point: | 231.1±13.0 °C at 760 mmHg |
| Refractive_Index: | 1.567 |
|---|---|
| Vapor_Pressure: | 0.1±0.4 mmHg at 25°C |
| Flash_Point: | 93.6±19.8 °C |
| LogP: | 0.33 |
| Bolling_Point: | 231.1±13.0 °C at 760 mmHg |
| FW: | 124.098 |
| PSA: | 58.71000 |
| Computational_Chemistry: | ['1. XlogP :N/A ', '2. Hydrogen Bond Donor Count :0 ', '3. Hydrogen Bond Acceptor Count :3 ', '4. Rotatable Bond Count :0 ', '5. Isotope Atom Count :N/A ', '6. TPSA 587 ', '7. Heavy Atom Count :9 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :104 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| Melting_Point: | 51-54 °C(lit.) |
| MF: | C5H4N2O2 |
| Exact_Mass: | 124.027275 |
| Density: | 1.3±0.1 g/cm3 |
| Safety_Statements: | S26 |
|---|---|
| Hazard_Codes: | Xn |
| HS_Code: | 2933399090 |
| Risk_Statements(EU): | R22:Harmful if swallowed. R36/37/38:Irritating to eyes, respiratory system and skin . |
| WGK_Germany: | 3 |
