![2-[1-(2-Thienyl)ethylidene]malononitrile (CAS: 10432-44-7) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0680661.png "2-[1-(2-Thienyl)ethylidene]malononitrile chemical structure")
2-[1-(2-Thienyl)ethylidene]malononitrile
Catalog No: FT-0680661
CAS No: 10432-44-7
- Chemical Name: 2-[1-(2-Thienyl)ethylidene]malononitrile
- Molecular Formula: C9H6N2S
- Molecular Weight: 174.22
- InChI Key: IVSVAOOOAGLVJQ-UHFFFAOYSA-N
- InChI: InChI=1S/C9H6N2S/c1-7(8(5-10)6-11)9-3-2-4-12-9/h2-4H,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | 88-90ºC |
|---|---|
| CAS: | 10432-44-7 |
| MF: | C9H6N2S |
| Flash_Point: | 133ºC |
| Product_Name: | 2-(1-thiophen-2-ylethylidene)propanedinitrile |
| Density: | 1.219g/cm3 |
| FW: | 174.22200 |
| Bolling_Point: | 296.3ºC at 760mmHg |
| Melting_Point: | 88-90ºC |
|---|---|
| Refractive_Index: | 1.588 |
| Vapor_Pressure: | 0.00144mmHg at 25°C |
| MF: | C9H6N2S |
| Flash_Point: | 133ºC |
| LogP: | 2.56876 |
| FW: | 174.22200 |
| Density: | 1.219g/cm3 |
| PSA: | 75.82000 |
| Bolling_Point: | 296.3ºC at 760mmHg |
| Exact_Mass: | 174.02500 |
| HS_Code: | 2934999090 |
|---|
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)