![3-Aminobicyclo[2.2.1]heptane-2-carboxylic acid (CAS: 104308-53-4) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0694609.png "3-Aminobicyclo[2.2.1]heptane-2-carboxylic acid chemical structure")
3-Aminobicyclo[2.2.1]heptane-2-carboxylic acid
Catalog No: FT-0694609
CAS No: 104308-53-4
- Chemical Name: 3-Aminobicyclo[2.2.1]heptane-2-carboxylic acid
- Molecular Formula: C8H15NO3
- Molecular Weight: 173.21
- InChI Key: KGMHNVXXWOSXSF-DABREVLYSA-N
- InChI: InChI=1S/C8H13NO2.H2O/c9-7-5-2-1-4(3-5)6(7)8(10)11;/h4-7H,1-3,9H2,(H,10,11);1H2/t4-,5+,6-,7+;/m0./s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | (1S,2S,3R,4R)-3-aminobicyclo[2.2.1]heptane-2-carboxylic acid,hydrate |
|---|---|
| Flash_Point: | 137.277ºC |
| Melting_Point: | -275ºC (dec.) |
| FW: | 155.19400 |
| Density: | 1.241g/cm3 |
| CAS: | 104308-53-4 |
| Bolling_Point: | 303.376ºC at 760 mmHg |
| MF: | C8H13NO2 |
| Density: | 1.241g/cm3 |
|---|---|
| LogP: | 1.14470 |
| Flash_Point: | 137.277ºC |
| Melting_Point: | -275ºC (dec.) |
| FW: | 155.19400 |
| PSA: | 63.32000 |
| Exact_Mass: | 155.09500 |
| MF: | C8H13NO2 |
| Bolling_Point: | 303.376ºC at 760 mmHg |
| Vapor_Pressure: | 0mmHg at 25°C |
| Refractive_Index: | 1.553 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| Risk_Statements(EU): | R36/37/38 |
| Safety_Statements: | 26-36 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)