6-CHLORO-1H-PYRROLO[3,2-B]PYRIDINE
Catalog No: FT-0652007
CAS No: 1021339-19-4
- Chemical Name: 6-CHLORO-1H-PYRROLO[3,2-B]PYRIDINE
- Molecular Formula: C7H5ClN2
- Molecular Weight: 152.58
- InChI Key: UWROBKHIEKWFAJ-UHFFFAOYSA-N
- InChI: InChI=1S/C7H5ClN2/c8-5-3-7-6(10-4-5)1-2-9-7/h1-4,9H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 152.581 |
| Density: | 1.4±0.1 g/cm3 |
| CAS: | 1021339-19-4 |
| Bolling_Point: | 290.5±20.0 °C at 760 mmHg |
| Product_Name: | 6-Chloro-1H-pyrrolo[3,2-b]pyridine |
| Melting_Point: | N/A |
| Flash_Point: | 157.1±7.4 °C |
| MF: | C7H5ClN2 |
| Density: | 1.4±0.1 g/cm3 |
|---|---|
| LogP: | 1.68 |
| Flash_Point: | 157.1±7.4 °C |
| Refractive_Index: | 1.703 |
| FW: | 152.581 |
| PSA: | 28.68000 |
| MF: | C7H5ClN2 |
| Bolling_Point: | 290.5±20.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| Exact_Mass: | 152.014130 |
| Hazard_Codes: | Xi |
|---|---|
| Warning_Statement: | P280-P305 + P351 + P338 |
| Safety_Statements: | H302-H318 |
| Symbol: | Danger |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933990090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)