2-Amino-4-methoxypyridine
Catalog No: FT-0648888
CAS No: 10201-73-7
- Chemical Name: 2-Amino-4-methoxypyridine
- Molecular Formula: C6H8N2O
- Molecular Weight: 124.14
- InChI Key: QPHBCOSULYSASF-UHFFFAOYSA-N
- InChI: InChI=1S/C6H8N2O/c1-9-5-2-3-8-6(7)4-5/h2-4H,1H3,(H2,7,8)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 124.141 |
| Density: | 1.1±0.1 g/cm3 |
| CAS: | 10201-73-7 |
| Bolling_Point: | 258.6±20.0 °C at 760 mmHg |
| Product_Name: | 2-Amino-4-methoxypyridine |
| Melting_Point: | 120-121ºC |
| Flash_Point: | 110.2±21.8 °C |
| MF: | C6H8N2O |
| Density: | 1.1±0.1 g/cm3 |
|---|---|
| LogP: | 0.87 |
| Flash_Point: | 110.2±21.8 °C |
| Melting_Point: | 120-121ºC |
| FW: | 124.141 |
| PSA: | 48.14000 |
| Exact_Mass: | 124.063660 |
| MF: | C6H8N2O |
| Bolling_Point: | 258.6±20.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.5 mmHg at 25°C |
| Refractive_Index: | 1.561 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H302-H315-H319-H335 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933399090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)