![6-iodo-1H-pyrrolo[3,2-b]pyridine (CAS: 1015609-75-2) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0726579.png "6-iodo-1H-pyrrolo[3,2-b]pyridine chemical structure")
6-iodo-1H-pyrrolo[3,2-b]pyridine
Catalog No: FT-0726579
CAS No: 1015609-75-2
- Chemical Name: 6-iodo-1H-pyrrolo[3,2-b]pyridine
- Molecular Formula: C7H5IN2
- Molecular Weight: 244.03
- InChI Key: XILKNEZBBWEDEH-UHFFFAOYSA-N
- InChI: InChI=1S/C7H5IN2/c8-5-3-7-6(10-4-5)1-2-9-7/h1-4,9H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 1015609-75-2 |
|---|---|
| MF: | C7H5IN2 |
| Density: | 2.1±0.1 g/cm3 |
| Flash_Point: | 171.9±22.3 °C |
| Melting_Point: | N/A |
| Product_Name: | 6-Iodo-1H-pyrrolo[3,2-b]pyridine |
| Symbol: | GHS07 |
| Bolling_Point: | 360.7±22.0 °C at 760 mmHg |
| FW: | 244.033 |
| Bolling_Point: | 360.7±22.0 °C at 760 mmHg |
|---|---|
| Density: | 2.1±0.1 g/cm3 |
| MF: | C7H5IN2 |
| LogP: | 2.06 |
| Exact_Mass: | 243.949738 |
| Vapor_Pressure: | 0.0±0.8 mmHg at 25°C |
| Flash_Point: | 171.9±22.3 °C |
| FW: | 244.033 |
| Refractive_Index: | 1.788 |
| PSA: | 28.68000 |
| Symbol: | GHS07 |
|---|---|
| RIDADR: | NONH for all modes of transport |
| Safety_Statements: | H302 |
