1H-PYRROLO[2,3-B]PYRIDIN-5-YLAMINE
Catalog No: FT-0649776
CAS No: 100960-07-4
- Chemical Name: 1H-PYRROLO[2,3-B]PYRIDIN-5-YLAMINE
- Molecular Formula: C7H7N3
- Molecular Weight: 133.15
- InChI Key: PLWBENCHEUFMTN-UHFFFAOYSA-N
- InChI: InChI=1S/C7H7N3/c8-6-3-5-1-2-9-7(5)10-4-6/h1-4H,8H2,(H,9,10)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 133.151 |
| Density: | 1.4±0.1 g/cm3 |
| CAS: | 100960-07-4 |
| Bolling_Point: | 363.0±22.0 °C at 760 mmHg |
| Product_Name: | 1H-Pyrrolo[2,3-b]pyridin-5-amin |
| Melting_Point: | 128-129ºC |
| Flash_Point: | 200.8±9.5 °C |
| MF: | C7H7N3 |
| Density: | 1.4±0.1 g/cm3 |
|---|---|
| LogP: | 1.07 |
| Flash_Point: | 200.8±9.5 °C |
| Melting_Point: | 128-129ºC |
| FW: | 133.151 |
| PSA: | 54.70000 |
| Exact_Mass: | 133.063995 |
| MF: | C7H7N3 |
| Bolling_Point: | 363.0±22.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.8 mmHg at 25°C |
| Refractive_Index: | 1.780 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| Warning_Statement: | P305 + P351 + P338 |
| Safety_Statements: | H302-H319 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)