3-Oxo-4-phenyl-butyric acid ethyl ester
Catalog No: FT-0600129
CAS No: 718-08-1
- Chemical Name: 3-Oxo-4-phenyl-butyric acid ethyl ester
- Molecular Formula: C12H14O3
- Molecular Weight: 206.24
- InChI Key: BOZNWXQZCYZCSH-UHFFFAOYSA-N
- InChI: InChI=1S/C12H14O3/c1-2-15-12(14)9-11(13)8-10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | N/A |
|---|---|
| CAS: | 718-08-1 |
| MF: | C12H14O3 |
| Flash_Point: | 123.9±20.4 °C |
| Product_Name: | Ethyl 3-oxo-4-phenylbutanoate |
| Density: | 1.1±0.1 g/cm3 |
| FW: | 206.238 |
| Bolling_Point: | 290.3±15.0 °C at 760 mmHg |
| Refractive_Index: | 1.506 |
|---|---|
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| MF: | C12H14O3 |
| Flash_Point: | 123.9±20.4 °C |
| LogP: | 2.45 |
| FW: | 206.238 |
| Density: | 1.1±0.1 g/cm3 |
| PSA: | 43.37000 |
| Bolling_Point: | 290.3±15.0 °C at 760 mmHg |
| Exact_Mass: | 206.094299 |
| Risk_Statements(EU): | R36/37/38 |
|---|---|
| HS_Code: | 2918300090 |
| Safety_Statements: | 26-36/37/39 |