CHEMBRDG-BB 5366312
Catalog No: FT-0649707
CAS No: 5233-04-5
- Chemical Name: CHEMBRDG-BB 5366312
- Molecular Formula: C6H6Cl2N2
- Molecular Weight: 177.03
- InChI Key: YWPGZWRHHRUXEK-UHFFFAOYSA-N
- InChI: InChI=1S/C6H6Cl2N2/c7-3-1-4(8)6(10)5(9)2-3/h1-2H,9-10H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 177.03100 |
| Density: | 1.501g/cm3 |
| CAS: | 5233-04-5 |
| Bolling_Point: | 318ºC at 760 mmHg |
| Product_Name: | chembrdg-bb 5366312 |
| Melting_Point: | N/A |
| Flash_Point: | 146.1ºC |
| MF: | C6H6Cl2N2 |
| Density: | 1.501g/cm3 |
|---|---|
| LogP: | 3.32020 |
| Flash_Point: | 146.1ºC |
| Refractive_Index: | 1.679 |
| FW: | 177.03100 |
| PSA: | 52.04000 |
| MF: | C6H6Cl2N2 |
| Bolling_Point: | 318ºC at 760 mmHg |
| Exact_Mass: | 175.99100 |
| Warning_Statement: | P261-P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H315-H319-H335 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2921590090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)