Olivetol
Catalog No: FT-0600424
CAS No: 500-66-3
- Chemical Name: Olivetol
 - Molecular Formula: C11H16O2
 - Molecular Weight: 180.24
 - InChI Key: IRMPFYJSHJGOPE-UHFFFAOYSA-N
 - InChI: InChI=1S/C11H16O2/c1-2-3-4-5-9-6-10(12)8-11(13)7-9/h6-8,12-13H,2-5H2,1H3
 
| Assay | Pack Size | Price | Stock | Action | 
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A | 
| Symbol: | GHS07 | 
|---|---|
| CAS: | 500-66-3 | 
| Flash_Point: | 148.8±14.2 °C | 
| Product_Name: | 5-Pentylbenzene-1,3-diol | 
| Bolling_Point: | 313.3±12.0 °C at 760 mmHg | 
| FW: | 180.243 | 
| Melting_Point: | 46-48ºC | 
| MF: | C11H16O2 | 
| Density: | 1.1±0.1 g/cm3 | 
| Refractive_Index: | 1.547 | 
|---|---|
| Vapor_Pressure: | 0.0±0.7 mmHg at 25°C | 
| Flash_Point: | 148.8±14.2 °C | 
| LogP: | 3.35 | 
| Bolling_Point: | 313.3±12.0 °C at 760 mmHg | 
| FW: | 180.243 | 
| PSA: | 40.46000 | 
| Computational_Chemistry: | ['1. XlogP :36 ', '2. Hydrogen Bond Donor Count :2 ', '3. Hydrogen Bond Acceptor Count :2 ', '4. Rotatable Bond Count :4 ', '5. Isotope Atom Count :10 ', '6. TPSA :405 ', '7. Heavy Atom Count :13 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :126 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] | 
| Melting_Point: | 46-48ºC | 
| MF: | C11H16O2 | 
| Exact_Mass: | 180.115036 | 
| Density: | 1.1±0.1 g/cm3 | 
| Symbol: | GHS07 | 
|---|---|
| RIDADR: | NONH for all modes of transport | 
| HS_Code: | 2907299090 | 
| Risk_Statements(EU): | R36/37/38 | 
| WGK_Germany: | 3 | 
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves | 
| RTECS: | VH2880000 | 
| Hazard_Codes: | Xi:Irritant; | 
| Warning_Statement: | P261-P305 + P351 + P338 | 
| Safety_Statements: | H315-H319-H335 | 
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)