3-Bromo-5-iodo-pyridine
Catalog No: FT-0649699
CAS No: 233770-01-9
- Chemical Name: 3-Bromo-5-iodo-pyridine
- Molecular Formula: C5H3BrIN
- Molecular Weight: 283.89
- InChI Key: AOOZLVWDZUPEHT-UHFFFAOYSA-N
- InChI: InChI=1S/C5H3BrIN/c6-4-1-5(7)3-8-2-4/h1-3H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS05, GHS07 |
|---|---|
| CAS: | 233770-01-9 |
| Flash_Point: | 115.0±23.2 °C |
| Product_Name: | 3-Bromo-5-iodopyridine |
| Bolling_Point: | 266.5±25.0 °C at 760 mmHg |
| FW: | 283.892 |
| Melting_Point: | 131.3-131.4ºC |
| MF: | C5H3BrIN |
| Density: | 2.3±0.1 g/cm3 |
| Refractive_Index: | 1.666 |
|---|---|
| Vapor_Pressure: | 0.0±0.5 mmHg at 25°C |
| Flash_Point: | 115.0±23.2 °C |
| LogP: | 2.83 |
| Bolling_Point: | 266.5±25.0 °C at 760 mmHg |
| FW: | 283.892 |
| PSA: | 12.89000 |
| Melting_Point: | 131.3-131.4ºC |
| MF: | C5H3BrIN |
| Exact_Mass: | 282.849335 |
| Density: | 2.3±0.1 g/cm3 |
| Symbol: | GHS05, GHS07 |
|---|---|
| Risk_Statements(EU): | R36/37/38 |
| HS_Code: | 2933399090 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi: Irritant;Xn: Harmful; |
| Warning_Statement: | P280-P305 + P351 + P338 |
| Safety_Statements: | H302-H318 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)