6-Chlorosalicylaldehyde
Catalog No: FT-0600833
CAS No: 18362-30-6
- Chemical Name: 6-Chlorosalicylaldehyde
- Molecular Formula: C7H5ClO2
- Molecular Weight: 156.56
- InChI Key: MVTWVXYIKIVAOJ-UHFFFAOYSA-N
- InChI: InChI=1S/C7H5ClO2/c8-6-2-1-3-7(10)5(6)4-9/h1-4,10H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 156.566 |
| Density: | 1.4±0.1 g/cm3 |
| CAS: | 18362-30-6 |
| Bolling_Point: | 223.1±20.0 °C at 760 mmHg |
| Product_Name: | 2-Chloro-6-hydroxybenzaldehyde |
| Melting_Point: | N/A |
| Flash_Point: | 88.8±21.8 °C |
| MF: | C7H5ClO2 |
| Density: | 1.4±0.1 g/cm3 |
|---|---|
| LogP: | 2.62 |
| Flash_Point: | 88.8±21.8 °C |
| Refractive_Index: | 1.632 |
| FW: | 156.566 |
| PSA: | 37.30000 |
| MF: | C7H5ClO2 |
| Bolling_Point: | 223.1±20.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.1±0.5 mmHg at 25°C |
| Exact_Mass: | 155.997803 |
| Warning_Statement: | P280-P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H302-H318 |
| Symbol: | Danger |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2913000090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)