2-BROMORESORCINOL
Catalog No: FT-0650729
CAS No: 6751-75-3
- Chemical Name: 2-BROMORESORCINOL
- Molecular Formula: C6H5BrO2
- Molecular Weight: 189.01
- InChI Key: UOLPZAPIFFZLMF-UHFFFAOYSA-N
- InChI: InChI=1S/C6H5BrO2/c7-6-4(8)2-1-3-5(6)9/h1-3,8-9H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 189.007 |
| Density: | 1.8±0.1 g/cm3 |
| CAS: | 6751-75-3 |
| Bolling_Point: | 235.3±20.0 °C at 760 mmHg |
| Product_Name: | 2-Bromo-1,3-benzenediol |
| Melting_Point: | 96-103ºC |
| Flash_Point: | 96.1±21.8 °C |
| MF: | C6H5BrO2 |
| Density: | 1.8±0.1 g/cm3 |
|---|---|
| LogP: | 1.97 |
| Flash_Point: | 96.1±21.8 °C |
| Melting_Point: | 96-103ºC |
| FW: | 189.007 |
| PSA: | 40.46000 |
| Exact_Mass: | 187.947281 |
| MF: | C6H5BrO2 |
| Bolling_Point: | 235.3±20.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.5 mmHg at 25°C |
| Refractive_Index: | 1.657 |
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
|---|---|
| Risk_Statements(EU): | 20/21/22-36/37/38 |
| Safety_Statements: | 26-37/39 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2908199090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)