1,10-Decanedioldimethacrylate
Catalog No: FT-0651106
CAS No: 6701-13-9
- Chemical Name: 1,10-Decanedioldimethacrylate
- Molecular Formula: C18H30O4
- Molecular Weight: 310.4
- InChI Key: LRZPQLZONWIQOJ-UHFFFAOYSA-N
- InChI: InChI=1S/C18H30O4/c1-15(2)17(19)21-13-11-9-7-5-6-8-10-12-14-22-18(20)16(3)4/h1,3,5-14H2,2,4H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 6701-13-9 |
| Flash_Point: | 181.0±18.8 °C |
| Product_Name: | 1,10-Decanediyl bis(2-methylacrylate) |
| Bolling_Point: | 386.9±15.0 °C at 760 mmHg |
| FW: | 310.428 |
| Melting_Point: | N/A |
| MF: | C18H30O4 |
| Density: | 1.0±0.1 g/cm3 |
| Refractive_Index: | 1.459 |
|---|---|
| Vapor_Pressure: | 0.0±0.9 mmHg at 25°C |
| MF: | C18H30O4 |
| Flash_Point: | 181.0±18.8 °C |
| LogP: | 6.19 |
| FW: | 310.428 |
| Density: | 1.0±0.1 g/cm3 |
| PSA: | 52.60000 |
| Bolling_Point: | 386.9±15.0 °C at 760 mmHg |
| Exact_Mass: | 310.214417 |
| Symbol: | GHS07 |
|---|---|
| HS_Code: | 2916190090 |
| RIDADR: | NONH for all modes of transport |
| Warning_Statement: | P305 + P351 + P338 |
| Safety_Statements: | H315-H319-H335 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)